EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H7N2O8 |
| Net Charge | 0 |
| Average Mass | 331.216 |
| Monoisotopic Mass | 331.02024 |
| SMILES | [O]c1c(O)c2nc(C(=O)O)cc(C(=O)O)c2c2nc(C(=O)O)cc12 |
| InChI | InChI=1S/C14H7N2O8/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18/h1-2,15,18H,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | VKRODJWIGYCXIB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrroloquinoline semiquinone (CHEBI:48452) is a pyrroloquinoline cofactor (CHEBI:26461) |
| pyrroloquinoline semiquinone (CHEBI:48452) is a semiquinone (CHEBI:15817) |
| pyrroloquinoline semiquinone (CHEBI:48452) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| (2,7,9-tricarboxy-5-hydroxy-1H-pyrrolo[2,3-f]quinolin-4-yl)oxidanyl |
| Synonyms | Source |
|---|---|
| 2,7,9-tricarboxy-1H-pyrrolo(2,3-f)quinoline-4-one-5-ol | ChemIDplus |
| 2,7,9-tricarboxypyrrolo(2,3-f)quinoline-4-ol-5-one | ChemIDplus |
| PQQH | ChemIDplus |
| pyrrolo-quinoline semiquinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:84371-05-1 | ChemIDplus |