EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48416 - olmesartan
| Formula | C24H26N6O3 |
| Net Charge | 0 |
| Average Mass | 446.511 |
| Monoisotopic Mass | 446.20664 |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C24H26N6O3/c1-4-7-19-25-21(24(2,3)33)20(23(31)32)30(19)14-15-10-12-16(13-11-15)17-8-5-6-9-18(17)22-26-28-29-27-22/h5-6,8-13,33H,4,7,14H2,1-3H3,(H,31,32)(H,26,27,28,29) |
| InChIKey | VTRAEEWXHOVJFV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olmesartan (CHEBI:48416) has role angiotensin receptor antagonist (CHEBI:61016) |
| olmesartan (CHEBI:48416) has role anti-arrhythmia drug (CHEBI:38070) |
| olmesartan (CHEBI:48416) has role antihypertensive agent (CHEBI:35674) |
| olmesartan (CHEBI:48416) has role antiviral agent (CHEBI:22587) |
| olmesartan (CHEBI:48416) is a biphenylyltetrazole (CHEBI:48420) |
| IUPAC Name |
|---|
| 4-(1-hydroxy-1-methylethyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1H-imidazole-5-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-(1-hydroxy-1-methylethyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-imidazole-5-carboxylic acid | IUPAC |
| 4-(hydroxy-1-methylethyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)-1,1'-biphenyl-4-yl]methyl}-1H-imidazole-5-carboxylic acid | IUPHAR |
| NSC-759810 | ChEMBL |
| olmesartan | IUPHAR |
| Olmesartan medoxomil impurity, olmesartan- | ChEMBL |
| RNH-6270 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB00275 | DrugBank |
| LSM-5893 | LINCS |
| Olmesartan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7502669 | Beilstein |
| CAS:144689-24-7 | ChemIDplus |
| Citations |
|---|