EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N6O3 |
| Net Charge | 0 |
| Average Mass | 446.511 |
| Monoisotopic Mass | 446.20664 |
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C24H26N6O3/c1-4-7-19-25-21(24(2,3)33)20(23(31)32)30(19)14-15-10-12-16(13-11-15)17-8-5-6-9-18(17)22-26-28-29-27-22/h5-6,8-13,33H,4,7,14H2,1-3H3,(H,31,32)(H,26,27,28,29) |
| InChIKey | VTRAEEWXHOVJFV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olmesartan (CHEBI:48416) has role angiotensin receptor antagonist (CHEBI:61016) |
| olmesartan (CHEBI:48416) has role antihypertensive agent (CHEBI:35674) |
| olmesartan (CHEBI:48416) is a biphenylyltetrazole (CHEBI:48420) |
| IUPAC Name |
|---|
| 4-(1-hydroxy-1-methylethyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1H-imidazole-5-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-(1-hydroxy-1-methylethyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-imidazole-5-carboxylic acid | IUPAC |
| 4-(hydroxy-1-methylethyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)-1,1'-biphenyl-4-yl]methyl}-1H-imidazole-5-carboxylic acid | IUPHAR |
| olmesartan | IUPHAR |
| Manual Xrefs | Databases |
|---|---|
| DB00275 | DrugBank |
| LSM-5893 | LINCS |
| Olmesartan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7502669 | Beilstein |
| CAS:144689-24-7 | ChemIDplus |