EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O3 |
| Net Charge | 0 |
| Average Mass | 280.408 |
| Monoisotopic Mass | 280.20384 |
| SMILES | CO[C@@H]1C(=O)CC[C@H](C(C)=O)[C@H]1/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C17H28O3/c1-11(2)7-6-8-12(3)16-14(13(4)18)9-10-15(19)17(16)20-5/h8,11,14,16-17H,6-7,9-10H2,1-5H3/b12-8+/t14-,16-,17-/m1/s1 |
| InChIKey | ZPVUPRFPDITERC-XKOQRQEVSA-N |
| Roles Classification |
|---|
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S,4S)-4-acetyl-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48413) has functional parent fumagalone (CHEBI:48530) |
| (2S,3S,4S)-4-acetyl-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48413) has role angiogenesis inhibitor (CHEBI:48422) |
| (2S,3S,4S)-4-acetyl-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48413) is a alicyclic ketone (CHEBI:36132) |
| IUPAC Name |
|---|
| (2S,3S,4S)-4-acetyl-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone |
| Synonym | Source |
|---|---|
| 2(S)-3(S)-4(S)-4-acetyl-3-(1,5-dimethyl-hex-1-enyl)-2-methoxycyclohexanone | Patent |
| Manual Xrefs | Databases |
|---|---|
| FR2872511 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9925474 | Reaxys |