EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25F3O3 |
| Net Charge | 0 |
| Average Mass | 334.378 |
| Monoisotopic Mass | 334.17558 |
| SMILES | CO[C@@H]1C(=O)CC[C@H](C(=O)C(F)(F)F)[C@H]1/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C17H25F3O3/c1-10(2)6-5-7-11(3)14-12(16(22)17(18,19)20)8-9-13(21)15(14)23-4/h7,10,12,14-15H,5-6,8-9H2,1-4H3/b11-7+/t12-,14+,15+/m0/s1 |
| InChIKey | MUKXQNBCKOXHTO-HRYNPVEISA-N |
| Roles Classification |
|---|
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S,4S)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]-4-(trifluoroacetyl)cyclohexanone (CHEBI:48412) has functional parent fumagalone (CHEBI:48530) |
| (2S,3S,4S)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]-4-(trifluoroacetyl)cyclohexanone (CHEBI:48412) has role angiogenesis inhibitor (CHEBI:48422) |
| (2S,3S,4S)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]-4-(trifluoroacetyl)cyclohexanone (CHEBI:48412) is a alicyclic ketone (CHEBI:36132) |
| (2S,3S,4S)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]-4-(trifluoroacetyl)cyclohexanone (CHEBI:48412) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| (2S,3S,4S)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]-4-(trifluoroacetyl)cyclohexanone |
| Synonym | Source |
|---|---|
| 2(S)-3(S)-4(S)-3-(1,5-dimethyl-hex-1-enyl)-2-methoxy-4-(2,2,2-trifluoroacetyl)-cyclohexanone | Patent |
| Manual Xrefs | Databases |
|---|---|
| FR2872511 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9941977 | Reaxys |