EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O3 |
| Net Charge | 0 |
| Average Mass | 268.397 |
| Monoisotopic Mass | 268.20384 |
| SMILES | CO[C@@H]1C(=O)CC[C@H](CO)[C@H]1/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C16H28O3/c1-11(2)6-5-7-12(3)15-13(10-17)8-9-14(18)16(15)19-4/h7,11,13,15-17H,5-6,8-10H2,1-4H3/b12-7+/t13-,15-,16-/m1/s1 |
| InChIKey | ULMJZNJSRRRTLJ-ULVLTVHJSA-N |
| Roles Classification |
|---|
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S,4S)-4-(hydroxymethyl)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48410) has functional parent cyclohexanone (CHEBI:17854) |
| (2S,3S,4S)-4-(hydroxymethyl)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48410) has functional parent fumagalone (CHEBI:48530) |
| (2S,3S,4S)-4-(hydroxymethyl)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48410) has role angiogenesis inhibitor (CHEBI:48422) |
| (2S,3S,4S)-4-(hydroxymethyl)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone (CHEBI:48410) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2S,3S,4S)-4-(hydroxymethyl)-2-methoxy-3-[(2E)-6-methylhept-2-en-2-yl]cyclohexanone |
| Synonym | Source |
|---|---|
| 2(S)-3(S)-4(S)-3-(1,5-dimethyl-hex-1-enyl)-4-hydroxymethyl-2-methoxycyclohexanone | Patent |
| Manual Xrefs | Databases |
|---|---|
| FR2872511 | Patent |