EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | [H]C(=O)c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3 |
| InChIKey | CBOQJANXLMLOSS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl vanillin (CHEBI:48408) has functional parent vanillin (CHEBI:18346) |
| ethyl vanillin (CHEBI:48408) has role antioxidant (CHEBI:22586) |
| ethyl vanillin (CHEBI:48408) has role flavouring agent (CHEBI:35617) |
| ethyl vanillin (CHEBI:48408) is a aromatic ether (CHEBI:35618) |
| ethyl vanillin (CHEBI:48408) is a benzaldehydes (CHEBI:22698) |
| ethyl vanillin (CHEBI:48408) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-ethoxy-4-hydroxybenzaldehyde |
| Synonyms | Source |
|---|---|
| 2-Ethoxy-4-formylphenol | ChemIDplus |
| ethyl protal | ChemIDplus |
| bourbonal | ChemIDplus |
| vanilal | ChemIDplus |
| 3-ethoxyprotocatechualdehyde | ChemIDplus |
| Ethyl vanillin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01086 | KEGG DRUG |
| CN101417931 | Patent |
| Ethylvanillin | Wikipedia |
| WO2011042365 | Patent |
| HMDB0029665 | HMDB |
| Citations |
|---|