EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO4 |
| Net Charge | 0 |
| Average Mass | 331.412 |
| Monoisotopic Mass | 331.17836 |
| SMILES | COc1cc2c(cc1OC)[C@]13C[C@@H](OC)[C@@H](O)C=C1CCN3CC2 |
| InChI | InChI=1S/C19H25NO4/c1-22-16-8-12-4-6-20-7-5-13-9-15(21)18(24-3)11-19(13,20)14(12)10-17(16)23-2/h8-10,15,18,21H,4-7,11H2,1-3H3/t15-,18+,19-/m0/s1 |
| InChIKey | YUWBVDCNLWYPIU-IPELMVKDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Erythratidine (CHEBI:4839) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Erythratidine | KEGG COMPOUND |