EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H4O10P3 |
| Net Charge | -1 |
| Average Mass | 256.944 |
| Monoisotopic Mass | 256.90228 |
| SMILES | O=P([O-])(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6)/p-1 |
| InChIKey | UNXRWKVEANCORM-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphosphate(1−) (CHEBI:48313) is a monovalent inorganic anion (CHEBI:79389) |
| triphosphate(1−) (CHEBI:48313) is a triphosphate ion (CHEBI:15266) |
| triphosphate(1−) (CHEBI:48313) is conjugate acid of triphosphate(2−) (CHEBI:48314) |
| triphosphate(1−) (CHEBI:48313) is conjugate base of triphosphoric acid (CHEBI:39949) |
| Incoming Relation(s) |
| triphosphoric acid (CHEBI:39949) is conjugate acid of triphosphate(1−) (CHEBI:48313) |
| triphosphate(2−) (CHEBI:48314) is conjugate base of triphosphate(1−) (CHEBI:48313) |
| IUPAC Name |
|---|
| tetrahydrogen triphosphate |
| Synonym | Source |
|---|---|
| H4P3O10− | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2467334 | Gmelin |