EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6Cl2O |
| Net Charge | 0 |
| Average Mass | 177.030 |
| Monoisotopic Mass | 175.97957 |
| SMILES | OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| InChIKey | DBHODFSFBXJZNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichlorobenzyl alcohol (CHEBI:48220) has role antiseptic drug (CHEBI:48218) |
| 2,4-dichlorobenzyl alcohol (CHEBI:48220) is a benzyl alcohols (CHEBI:22743) |
| 2,4-dichlorobenzyl alcohol (CHEBI:48220) is a dichlorobenzene (CHEBI:23697) |
| IUPAC Name |
|---|
| (2,4-dichlorophenyl)methanol |
| Synonyms | Source |
|---|---|
| 2,4-dichlorobenzenemethanol | ChemIDplus |
| 2,4-dichlorobenzyl alcohol | ChemIDplus |
| Dybenal | ChemIDplus |