EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O |
| Net Charge | 0 |
| Average Mass | 178.275 |
| Monoisotopic Mass | 178.13577 |
| SMILES | CCCCCc1ccc(C)cc1O |
| InChI | InChI=1S/C12H18O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13/h7-9,13H,3-6H2,1-2H3 |
| InChIKey | CKGWFZQGEQJZIL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amylmetacresol (CHEBI:48213) has functional parent m-cresol (CHEBI:17231) |
| amylmetacresol (CHEBI:48213) has role antiseptic drug (CHEBI:48218) |
| amylmetacresol (CHEBI:48213) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-methyl-2-pentylphenol |
| Synonyms | Source |
|---|---|
| Amylmetacresol | ChemIDplus |
| 6-amyl-m-cresol | ChemIDplus |
| 6-n-amyl-m-cresol | ChemIDplus |
| 6-n-pentyl-m-cresol | ChemIDplus |
| amylmetacresolum | ChemIDplus |
| 6-pentyl-m-cresol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2440952 | Beilstein |
| CAS:1300-94-3 | ChemIDplus |