EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O6 |
| Net Charge | 0 |
| Average Mass | 328.320 |
| Monoisotopic Mass | 328.09469 |
| SMILES | [H][C@@]12CC(=O)O[C@]1([H])C1=C(C(=O)c3c(O)cccc3C1=O)[C@@H](CCC)O2 |
| InChI | InChI=1S/C18H16O6/c1-2-4-10-14-15(18-11(23-10)7-12(20)24-18)16(21)8-5-3-6-9(19)13(8)17(14)22/h3,5-6,10-11,18-19H,2,4,7H2,1H3/t10-,11-,18+/m1/s1 |
| InChIKey | AVCPRTNVVRPELB-YRUZYCQGSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| frenolicin B (CHEBI:48201) has role metabolite (CHEBI:25212) |
| frenolicin B (CHEBI:48201) is a p-quinones (CHEBI:25830) |
| frenolicin B (CHEBI:48201) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (3aR,5R,11bR)-7-hydroxy-5-propyl-3,3a,5,11b-tetrahydro-2H-furo[3,2-b]naphtho[2,3-d]pyran-2,6,11-trione |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6436493 | Beilstein |
| CAS:68930-68-7 | ChemIDplus |