EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O10 |
| Net Charge | 0 |
| Average Mass | 446.408 |
| Monoisotopic Mass | 446.12130 |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)O[C@]2(O[C@H](CC(=O)O)CC3=C2C(=O)c2c(O)cccc2C3=O)[C@H]1O |
| InChI | InChI=1S/C22H22O10/c1-9-6-15(30-10(2)23)21(29)22(31-9)18-13(7-11(32-22)8-16(25)26)19(27)12-4-3-5-14(24)17(12)20(18)28/h3-5,9,11,15,21,24,29H,6-8H2,1-2H3,(H,25,26)/t9-,11+,15-,21+,22-/m1/s1 |
| InChIKey | ZALAFWZWSLVCID-VXUQJGMHSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| griseusin B (CHEBI:48200) has role metabolite (CHEBI:25212) |
| griseusin B (CHEBI:48200) is a p-quinones (CHEBI:25830) |
| griseusin B (CHEBI:48200) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| [(1R,3S,3'S,4'R,6'R)-4'-acetoxy-3',9-dihydroxy-6'-methyl-5,10-dioxo-3,3',4,4',5,5',6',10-octahydrospiro[naphtho[2,3-c]pyran-1,2'-pyran]-3-yl]acetic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5184599 | Beilstein |