EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O6 |
| Net Charge | 0 |
| Average Mass | 166.129 |
| Monoisotopic Mass | 166.04774 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m0/s1 |
| InChIKey | QXKAIJAYHKCRRA-NUNKFHFFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-xylonic acid (CHEBI:48092) is a xylonic acid (CHEBI:33828) |
| L-xylonic acid (CHEBI:48092) is conjugate acid of L-xylonate (CHEBI:28146) |
| L-xylonic acid (CHEBI:48092) is enantiomer of D-xylonic acid (CHEBI:48093) |
| Incoming Relation(s) |
| L-xylono-1,4-lactone (CHEBI:18118) has functional parent L-xylonic acid (CHEBI:48092) |
| L-xylonate (CHEBI:28146) is conjugate base of L-xylonic acid (CHEBI:48092) |
| D-xylonic acid (CHEBI:48093) is enantiomer of L-xylonic acid (CHEBI:48092) |
| IUPAC Names |
|---|
| (2S,3R,4S)-2,3,4,5-tetrahydroxypentanoic acid |
| L-xylonic acid |
| Synonym | Source |
|---|---|
| L-Xylonate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05411 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3589755 | Beilstein |