EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N4O6 |
| Net Charge | 0 |
| Average Mass | 436.509 |
| Monoisotopic Mass | 436.23218 |
| SMILES | [H][C@]12CCCN1C(=O)[C@H](CCCCCC(=O)C1CO1)NC(=O)[C@@H](C)NC(=O)[C@H](C)NC2=O |
| InChI | InChI=1S/C21H32N4O6/c1-12-18(27)22-13(2)19(28)24-14(7-4-3-5-9-16(26)17-11-31-17)21(30)25-10-6-8-15(25)20(29)23-12/h12-15,17H,3-11H2,1-2H3,(H,22,27)(H,23,29)(H,24,28)/t12-,13+,14-,15+,17?/m0/s1 |
| InChIKey | GNYCTMYOHGBSBI-KVUCBBCISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). phytotoxin Any toxin produced by a plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HC toxin (CHEBI:48028) has role antineoplastic agent (CHEBI:35610) |
| HC toxin (CHEBI:48028) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| HC toxin (CHEBI:48028) has role metabolite (CHEBI:25212) |
| HC toxin (CHEBI:48028) has role phytotoxin (CHEBI:38231) |
| HC toxin (CHEBI:48028) is a homodetic cyclic peptide (CHEBI:24613) |
| HC toxin (CHEBI:48028) is a tetrapeptide (CHEBI:48030) |
| Synonyms | Source |
|---|---|
| Cyclo(2-amino-8-oxo-9,10-epoxydecanoic acid-prolyl-alanyl-alanine) | ChemIDplus |
| Cyclo(aoe-pro-ala-ala) | ChemIDplus |
| HC-toxin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4729824 | Reaxys |
| CAS:83209-65-8 | ChemIDplus |
| CAS:83209-65-8 | KEGG COMPOUND |
| Citations |
|---|