EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O3 |
| Net Charge | 0 |
| Average Mass | 240.258 |
| Monoisotopic Mass | 240.07864 |
| SMILES | O=C1C[C@@H](c2cccc(O)c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H12O3/c16-11-5-3-4-10(8-11)15-9-13(17)12-6-1-2-7-14(12)18-15/h1-8,15-16H,9H2/t15-/m0/s1 |
| InChIKey | JVSPTYZZNUXJHN-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-3'-hydroxyflavanone (CHEBI:48023) is a 3'-hydroxyflavanone (CHEBI:48022) |
| IUPAC Name |
|---|
| (2S)-2-(3-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1288275 | Beilstein |