EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N3O4 |
| Net Charge | 0 |
| Average Mass | 369.421 |
| Monoisotopic Mass | 369.16886 |
| SMILES | N#Cc1ccccc1OCC(O)CNCCNC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H23N3O4/c21-12-16-3-1-2-4-19(16)27-14-18(25)13-22-9-10-23-20(26)11-15-5-7-17(24)8-6-15/h1-8,18,22,24-25H,9-11,13-14H2,(H,23,26) |
| InChIKey | YARKMNAWFIMDKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epanolol (CHEBI:4800) has role cardiovascular drug (CHEBI:35554) |
| Epanolol (CHEBI:4800) is a acetamides (CHEBI:22160) |
| Synonyms | Source |
|---|---|
| Epanolol | KEGG COMPOUND |
| ICI 141,292 | ChEMBL |
| ICI-141,292 | DrugCentral |
| ICI-141292 | ChEMBL |
| Citations |
|---|