EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | O=C(O)[C@H](Cc1ccccc1)N(O)O |
| InChI | InChI=1S/C9H11NO4/c11-9(12)8(10(13)14)6-7-4-2-1-3-5-7/h1-5,8,13-14H,6H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | IDBRDXGJPFCEFF-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-phenylalanine (CHEBI:47991) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxy-L-phenylalanine (CHEBI:47991) is a L-phenylalanine derivative (CHEBI:84144) |
| N,N-dihydroxy-L-phenylalanine (CHEBI:47991) is conjugate acid of N,N-dihydroxy-L-phenylalaninate (CHEBI:58727) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-phenylalaninate (CHEBI:58727) is conjugate base of N,N-dihydroxy-L-phenylalanine (CHEBI:47991) |
| IUPAC Name |
|---|
| N,N-dihydroxy-L-phenylalanine |