EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | C[C@H](C(=O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/t2-,3-/m0/s1 |
| InChIKey | LXRUAYBIUSUULX-HRFVKAFMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| threo-3-methyl-L-aspartic acid (CHEBI:47980) is a amino dicarboxylic acid (CHEBI:36164) |
| threo-3-methyl-L-aspartic acid (CHEBI:47980) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| threo-3-methyl-L-aspartic acid (CHEBI:47980) is conjugate acid of threo-3-methyl-L-aspartate(1−) (CHEBI:58724) |
| Incoming Relation(s) |
| threo-3-methyl-L-aspartate(1−) (CHEBI:58724) is conjugate base of threo-3-methyl-L-aspartic acid (CHEBI:47980) |
| IUPAC Names |
|---|
| (2S,3S)-2-amino-3-methylbutanedioic acid |
| (3S)-3-methyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| 2S,3S-3-METHYLASPARTIC ACID | PDBeChem |
| L-threo-3-Methylaspartate | KEGG COMPOUND |
| Citations |
|---|