EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N3O5 |
| Net Charge | 0 |
| Average Mass | 305.290 |
| Monoisotopic Mass | 305.10117 |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O5/c1-3-16(4-2)14(20)10(8-15)5-9-6-11(17(21)22)13(19)12(18)7-9/h5-7,18-19H,3-4H2,1-2H3/b10-5+ |
| InChIKey | JRURYQJSLYLRLN-BJMVGYQFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.1.1.6 (catechol O-methyltransferase) inhibitor An EC 2.1.1.* (methyltransferase) inhibitor that interferes with the action of catechol O-methyltransferase (EC 2.1.1.6). |
| Applications: | central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| entacapone (CHEBI:4798) has role antidyskinesia agent (CHEBI:66956) |
| entacapone (CHEBI:4798) has role antiparkinson drug (CHEBI:48407) |
| entacapone (CHEBI:4798) has role central nervous system drug (CHEBI:35470) |
| entacapone (CHEBI:4798) has role EC 2.1.1.6 (catechol O-methyltransferase) inhibitor (CHEBI:48406) |
| entacapone (CHEBI:4798) is a 2-nitrophenols (CHEBI:86421) |
| entacapone (CHEBI:4798) is a catechols (CHEBI:33566) |
| entacapone (CHEBI:4798) is a monocarboxylic acid amide (CHEBI:29347) |
| entacapone (CHEBI:4798) is a nitrile (CHEBI:18379) |
| Incoming Relation(s) |
| 3-O-ethylentacapone (CHEBI:48380) has functional parent entacapone (CHEBI:4798) |
| 3-O-methylentacapone (CHEBI:48381) has functional parent entacapone (CHEBI:4798) |
| IUPAC Name |
|---|
| (2E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide |
| INNs | Source |
|---|---|
| entacapona | ChemIDplus |
| entacapone | KEGG DRUG |
| entacaponum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Comtess | DrugBank |
| (E)-alpha-Cyano-N,N-diethyl-3,4-dihydroxy-5-nitrocinnamamide | ChemIDplus |
| N,N-diethyl-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl) acrylamide | Patent |
| Entacapone | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Comtan | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1018 | DrugCentral |
| C07943 | KEGG COMPOUND |
| D00781 | KEGG DRUG |
| DB00494 | DrugBank |
| Entacapone | Wikipedia |
| EP426468 | Patent |
| US5135950 | Patent |
| US6599530 | Patent |
| WO2005063693 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8158723 | Reaxys |
| CAS:130929-57-6 | ChemIDplus |
| CAS:130929-57-6 | KEGG COMPOUND |
| Citations |
|---|