EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47962 - aldehydo-D-galacturonic acid
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | [H]C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[o2112A]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4+,5-/m0/s1 |
| InChIKey | IAJILQKETJEXLJ-RSJOWCBRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-D-galacturonic acid (CHEBI:47962) is a D-galacturonic acid (CHEBI:18024) |
| aldehydo-D-galacturonic acid (CHEBI:47962) is conjugate acid of aldehydo-D-galacturonate (CHEBI:12952) |
| Incoming Relation(s) |
| aldehydo-D-galacturonate (CHEBI:12952) is conjugate base of aldehydo-D-galacturonic acid (CHEBI:47962) |
| IUPAC Name |
|---|
| aldehydo-D-galacturonic acid |
| Synonyms | Source |
|---|---|
| (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid | IUPAC |
| D-galacturonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1727087 | Beilstein |
| Gmelin:465146 | Gmelin |
| CAS:685-73-4 | ChemIDplus |