EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O6 |
| Net Charge | 0 |
| Average Mass | 586.689 |
| Monoisotopic Mass | 586.27913 |
| SMILES | CC=C1/C(=C/C2=N/C(=C\c3nc(/C=C4\NC(=O)C(CC)=C4C)c(C)c3CCC(=O)O)C(CCC(=O)O)=C2C)NC(=O)[C@@H]1C |
| InChI | InChI=1S/C33H38N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7,13-15,19,34H,8-12H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b20-7?,26-13-,27-14-,29-15-/t19-/m1/s1 |
| InChIKey | XAVVMXGLKJSJDU-AHRHCINWSA-N |
| Roles Classification |
|---|
| Chemical Role: | phytochrome chromophore A chromophore that is a linear tetrapyrrolic prosthetic group covalently attached to a large soluble protein phytochrome. Light absorption by the phytochrome chromophore triggers photoconversion between two spectrally distinct forms of the photoreceptor: Pr, the red light absorbing form, and Pfr, the far-red light absorbing form. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-phycocyanobilin (CHEBI:47955) is a phycocyanobilin (CHEBI:48863) |
| Incoming Relation(s) |
| (2R,3Z)-phycocyanobilin (CHEBI:15617) is a (2R)-phycocyanobilin (CHEBI:47955) |
| (3E)-phycocyanobilin (CHEBI:47957) is a (2R)-phycocyanobilin (CHEBI:47955) |
| IUPAC Name |
|---|
| (2R)-8,12-bis(2-carboxyethyl)-18-ethyl-3-ethylidene-2,7,13,17-tetramethyl-2,3-dihydrobilin-1,19(21H,24H)-dione |