EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha122A-2b_2-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-6(12)4(9)2(8)3(13-6)5(10)11/h2-4,7-9,12H,1H2,(H,10,11)/t2-,3+,4+,6-/m1/s1 |
| InChIKey | PTCIWUZVDIQTOW-SHPLCBCASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-fructuronic acid (CHEBI:47949) has functional parent β-D-fructofuranose (CHEBI:28645) |
| β-D-fructuronic acid (CHEBI:47949) is a D-fructofuranuronic acid (CHEBI:4126) |
| β-D-fructuronic acid (CHEBI:47949) is conjugate acid of β-D-fructuronate (CHEBI:59883) |
| Incoming Relation(s) |
| β-D-fructuronate (CHEBI:59883) is conjugate base of β-D-fructuronic acid (CHEBI:47949) |
| IUPAC Name |
|---|
| α-D-lyxo-hex-5-ulofuranosonic acid |
| Synonym | Source |
|---|---|
| β-D-fructofuranuronic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7166677 | Beilstein |