EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O3 |
| Net Charge | -1 |
| Average Mass | 163.152 |
| Monoisotopic Mass | 163.04007 |
| SMILES | O=C([O-])/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/p-1/b5-4+ |
| InChIKey | KKSDGJDHHZEWEP-SNAWJCMRSA-M |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-coumarate (CHEBI:47928) has role human xenobiotic metabolite (CHEBI:76967) |
| trans-3-coumarate (CHEBI:47928) has role plant metabolite (CHEBI:76924) |
| trans-3-coumarate (CHEBI:47928) is a 3-coumarate (CHEBI:47927) |
| trans-3-coumarate (CHEBI:47928) is conjugate base of trans-3-coumaric acid (CHEBI:32357) |
| Incoming Relation(s) |
| trans-3-coumaric acid (CHEBI:32357) is conjugate acid of trans-3-coumarate (CHEBI:47928) |
| IUPAC Name |
|---|
| (2E)-3-(3-hydroxyphenyl)prop-2-enoate |
| Synonym | Source |
|---|---|
| (2E)-3-(3-hydroxyphenyl)acrylate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E)-3-(3-hydroxyphenyl)prop-2-enoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2245729 | Gmelin |