EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O3 |
| Net Charge | 0 |
| Average Mass | 164.160 |
| Monoisotopic Mass | 164.04734 |
| SMILES | O=C(O)/C=C\c1cccc(O)c1 |
| InChI | InChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4- |
| InChIKey | KKSDGJDHHZEWEP-PLNGDYQASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-3-coumaric acid (CHEBI:47926) is a 3-coumaric acid (CHEBI:47925) |
| IUPAC Name |
|---|
| (2Z)-3-(3-hydroxyphenyl)prop-2-enoic acid |
| Synonym | Source |
|---|---|
| (2Z)-3-(3-hydroxyphenyl)acrylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3196644 | Reaxys |