EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44N4O5 |
| Net Charge | 0 |
| Average Mass | 576.738 |
| Monoisotopic Mass | 576.33117 |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)OC)C(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C33H44N4O5/c1-22(34-2)30(38)35-28(25-18-11-6-12-19-25)32(40)37-21-13-20-26(37)31(39)36-29(33(41)42-3)27(23-14-7-4-8-15-23)24-16-9-5-10-17-24/h4-5,7-10,14-17,22,25-29,34H,6,11-13,18-21H2,1-3H3,(H,35,38)(H,36,39)/t22-,26-,28-,29-/m0/s1 |
| InChIKey | UUPZYAHONNHULX-CJBSCAABSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | IAP antagonist An antagonist of the inhibitor of apoptosis proteins. Inhibitors of apoptosis proteins (IAP) are a family of functionally and structurally related proteins that serve as endogenous inhibitors of programmed cell death (apoptosis). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 1-{(2S)-2-cyclohexyl-2-[(N-methyl-L-alanyl)amino]acetyl}-L-prolyl-β-phenyl-L-phenylalaninate (CHEBI:47922) has role IAP antagonist (CHEBI:229692) |
| methyl 1-{(2S)-2-cyclohexyl-2-[(N-methyl-L-alanyl)amino]acetyl}-L-prolyl-β-phenyl-L-phenylalaninate (CHEBI:47922) is a methyl ester (CHEBI:25248) |
| methyl 1-{(2S)-2-cyclohexyl-2-[(N-methyl-L-alanyl)amino]acetyl}-L-prolyl-β-phenyl-L-phenylalaninate (CHEBI:47922) is a tetrapeptide (CHEBI:48030) |
| Incoming Relation(s) |
| N,N'-(hexane-1,6-diyl)bis(1-{(2S)-2-cyclohexyl-2-[(N-methyl-L-alanyl)amino]acetyl}-L-prolyl-β-phenyl-L-phenylalaninamide) (CHEBI:47924) has functional parent methyl 1-{(2S)-2-cyclohexyl-2-[(N-methyl-L-alanyl)amino]acetyl}-L-prolyl-β-phenyl-L-phenylalaninate (CHEBI:47922) |
| IUPAC Name |
|---|
| methyl 1-{(2S)-2-cyclohexyl-2-[(N-methyl-L-alanyl)amino]acetyl}-L-prolyl-β-phenyl-L-phenylalaninate |
| Synonyms | Source |
|---|---|
| MV 1 | ChEBI |
| MV-1 | ChEBI |
| MV1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1001600-54-9 | ChEBI |
| Citations |
|---|