EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4791 - endosulfan
| Formula | C9H6Cl6O3S |
| Net Charge | 0 |
| Average Mass | 406.929 |
| Monoisotopic Mass | 403.81688 |
| SMILES | O=S1OCC2C(CO1)C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2 |
| InChIKey | RDYMFSUJUZBWLH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Role: | |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endosulfan (CHEBI:4791) has role acaricide (CHEBI:22153) |
| endosulfan (CHEBI:4791) has role agrochemical (CHEBI:33286) |
| endosulfan (CHEBI:4791) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| endosulfan (CHEBI:4791) has role persistent organic pollutant (CHEBI:77853) |
| endosulfan (CHEBI:4791) is a cyclic sulfite ester (CHEBI:39089) |
| endosulfan (CHEBI:4791) is a cyclodiene organochlorine insecticide (CHEBI:23457) |
| IUPAC Name |
|---|
| 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepine 3-oxide |
| Synonyms | Source |
|---|---|
| Endosulfan | KEGG COMPOUND |
| 1,9,10,11,12,12-hexachloro-4,6-dioxa-5-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide | IUPAC |
| 1,4,5,6,7,7-Hexachloro-5-norbornene-2,3-dimethanol cyclic sulfite | ChemIDplus |
| 1,4,5,6,7,7-Hexachloro-8,9,10-trinorborn-5-en-2,3-ylenedimethyl sulphite | ChemIDplus |
| alpha,beta-1,2,3,4,7,7-Hexachlorobicyclo(2.2.1)-2-heptene-5,6-bisoxymethylene sulfite | ChemIDplus |
| Benzoepin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11090 | KEGG COMPOUND |
| CN103074276 | Patent |
| CN102601109 | Patent |
| ZW5287 | Patent |
| Endosulfan | Wikipedia |
| 264 | PPDB |