EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N5 |
| Net Charge | 0 |
| Average Mass | 135.130 |
| Monoisotopic Mass | 135.05450 |
| SMILES | Nc1ncc2ncnc2n1 |
| InChI | InChI=1S/C5H5N5/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H3,6,7,8,9,10) |
| InChIKey | MWBWWFOAEOYUST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminopurine (CHEBI:479072) has role antimetabolite (CHEBI:35221) |
| 2-aminopurine (CHEBI:479072) is a 2-aminopurines (CHEBI:20702) |
| 2-aminopurine (CHEBI:479072) is a nucleobase analogue (CHEBI:67142) |
| Incoming Relation(s) |
| 2-amino-cPuMP (CHEBI:84628) has functional parent 2-aminopurine (CHEBI:479072) |
| IUPAC Name |
|---|
| 9H-purin-2-amine |
| Synonyms | Source |
|---|---|
| 1H-purin-2-amine | ChemIDplus |
| 2-amino purine | ChEBI |
| 2'-amino-purine | ChEBI |
| Citations |
|---|