EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O2S |
| Net Charge | 0 |
| Average Mass | 106.146 |
| Monoisotopic Mass | 106.00885 |
| SMILES | C[C@@H](S)C(=O)O |
| InChI | InChI=1S/C3H6O2S/c1-2(6)3(4)5/h2,6H,1H3,(H,4,5)/t2-/m1/s1 |
| InChIKey | PMNLUUOXGOOLSP-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-mercaptopropanoic acid (CHEBI:47874) is a 2-mercaptopropanoic acid (CHEBI:47872) |
| (R)-2-mercaptopropanoic acid (CHEBI:47874) is enantiomer of (S)-2-mercaptopropanoic acid (CHEBI:47873) |
| Incoming Relation(s) |
| (S)-2-mercaptopropanoic acid (CHEBI:47873) is enantiomer of (R)-2-mercaptopropanoic acid (CHEBI:47874) |
| IUPAC Name |
|---|
| (2R)-2-sulfanylpropanoic acid |
| Synonym | Source |
|---|---|
| (2R)-2-mercaptopropanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1720255 | Beilstein |