EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47819 - N5-[amino(hydroxyimino)methyl]-L-ornithine
| Formula | C6H14N4O3 |
| Net Charge | 0 |
| Average Mass | 190.203 |
| Monoisotopic Mass | 190.10659 |
| SMILES | NC(=NO)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(11)12)2-1-3-9-6(8)10-13/h4,13H,1-3,7H2,(H,11,12)(H3,8,9,10)/t4-/m0/s1 |
| InChIKey | FQWRAVYMZULPNK-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) is a N5-[amino(hydroxyimino)methyl]ornithine (CHEBI:47826) |
| N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) is a Nω-hydroxy-L-arginine (CHEBI:28538) |
| N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) is tautomer of N5-[(hydroxyamino)(imino)methyl]-L-ornithine (CHEBI:43088) |
| N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) is tautomer of N5-[amino(hydroxyimino)methyl]-L-ornithine zwitterion (CHEBI:60111) |
| Incoming Relation(s) |
| N5-[(E)-amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47821) is a N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) |
| N5-[(Z)-amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47822) is a N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) |
| N5-[(hydroxyamino)(imino)methyl]-L-ornithine (CHEBI:43088) is tautomer of N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) |
| N5-[amino(hydroxyimino)methyl]-L-ornithine zwitterion (CHEBI:60111) is tautomer of N5-[amino(hydroxyimino)methyl]-L-ornithine (CHEBI:47819) |
| IUPAC Name |
|---|
| N5-[amino(hydroxyimino)methyl]-L-ornithine |
| Manual Xrefs | Databases |
|---|---|
| HAR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4310566 | Beilstein |