EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O3 |
| Net Charge | 0 |
| Average Mass | 190.203 |
| Monoisotopic Mass | 190.10659 |
| SMILES | N=C(N)N(O)CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(11)12)2-1-3-10(13)6(8)9/h4,13H,1-3,7H2,(H3,8,9)(H,11,12)/t4-/m0/s1 |
| InChIKey | KWDSFGYQALRPMG-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nδ-hydroxy-L-arginine (CHEBI:47817) is a hydroxy-L-arginine (CHEBI:24658) |
| Nδ-hydroxy-L-arginine (CHEBI:47817) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| N5-[amino(imino)methyl]-N5-hydroxy-L-ornithine |
| Synonyms | Source |
|---|---|
| N5-hydroxy-L-arginine | ChemIDplus |
| N5-(aminoiminomethyl)-N5-hydroxy-L-ornithine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6713408 | Beilstein |
| CAS:42599-90-6 | ChemIDplus |