EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O3 |
| Net Charge | 0 |
| Average Mass | 190.203 |
| Monoisotopic Mass | 190.10659 |
| SMILES | N=C(N)NC[C@H](O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(12)13)1-3(11)2-10-6(8)9/h3-4,11H,1-2,7H2,(H,12,13)(H4,8,9,10)/t3-,4+/m1/s1 |
| InChIKey | OPCBKDJCJYBGTQ-DMTCNVIQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-4-hydroxy-L-arginine (CHEBI:47816) is a γ-hydroxy-L-arginine (CHEBI:47815) |
| IUPAC Name |
|---|
| (4R)-4-hydroxy-L-arginine |
| Synonym | Source |
|---|---|
| (2S,4R)-2-amino-5-{[amino(imino)methyl]amino}-4-hydroxypentanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1726796 | Beilstein |