EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NOS2 |
| Net Charge | 0 |
| Average Mass | 177.294 |
| Monoisotopic Mass | 177.02821 |
| SMILES | C[S@](=O)CCCCN=C=S |
| InChI | InChI=1S/C6H11NOS2/c1-10(8)5-3-2-4-7-6-9/h2-5H2,1H3/t10-/m0/s1 |
| InChIKey | SUVMJBTUFCVSAD-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-sulforaphane (CHEBI:47809) is a sulforaphane (CHEBI:47807) |
| (S)-sulforaphane (CHEBI:47809) is enantiomer of (R)-sulforaphane (CHEBI:47808) |
| Incoming Relation(s) |
| (R)-sulforaphane (CHEBI:47808) is enantiomer of (S)-sulforaphane (CHEBI:47809) |
| IUPAC Name |
|---|
| 1-isothiocyanato-4-[(S)-methylsulfinyl]butane |
| Synonym | Source |
|---|---|
| 4-isothiocyanatobutyl methyl (S)-sulfoxide | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1723239 | Beilstein |