EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2O2S |
| Net Charge | 0 |
| Average Mass | 246.291 |
| Monoisotopic Mass | 246.04630 |
| SMILES | [H]n1cc(C2=N[C@@H](C(=O)O)CS2)c2ccccc21 |
| InChI | InChI=1S/C12H10N2O2S/c15-12(16)10-6-17-11(14-10)8-5-13-9-4-2-1-3-7(8)9/h1-5,10,13H,6H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | GTTVJFCVXYCPHB-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-dihydrocamalexic acid (CHEBI:47796) is a dihydrocamalexic acid (CHEBI:47794) |
| (S)-dihydrocamalexic acid (CHEBI:47796) is conjugate acid of (S)-dihydrocamalexate (CHEBI:71048) |
| (S)-dihydrocamalexic acid (CHEBI:47796) is enantiomer of (R)-dihydrocamalexic acid (CHEBI:47795) |
| Incoming Relation(s) |
| (S)-dihydrocamalexate (CHEBI:71048) is conjugate base of (S)-dihydrocamalexic acid (CHEBI:47796) |
| (R)-dihydrocamalexic acid (CHEBI:47795) is enantiomer of (S)-dihydrocamalexic acid (CHEBI:47796) |
| Synonym | Source |
|---|---|
| (4S)-2-(1H-indol-3-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid | ChEBI |
| Citations |
|---|