EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | Cc1cc(O)cc2c1O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C27H46O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(28)18-23(5)26(24)29-27/h18-22,28H,7-17H2,1-6H3/t21-,22-,27-/m1/s1 |
| InChIKey | GZIFEOYASATJEH-VHFRWLAGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (12772433) | |
| Panax ginseng (ncbitaxon:4054) | - | MetaboLights (MTBLS350) | From MetaboLights |
| Roles Classification |
|---|
| Chemical Roles: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-tocopherol (CHEBI:47772) has role food antioxidant (CHEBI:77962) |
| δ-tocopherol (CHEBI:47772) has role plant metabolite (CHEBI:76924) |
| δ-tocopherol (CHEBI:47772) is a tocopherol (CHEBI:27013) |
| δ-tocopherol (CHEBI:47772) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| (2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| (2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol | ChEBI |
| (2R)-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chroman-6-ol | ChEBI |
| (2R)-3,4-dihydro-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol | ChemIDplus |
| (2R,4'R,8'R)-δ-tocopherol | ChEBI |
| 8-methyltocol | ChEBI |
| UniProt Name | Source |
|---|---|
| δ-tocopherol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 83144 | ChemSpider |
| C00007363 | KNApSAcK |
| C14151 | KEGG COMPOUND |
| Delta-Tocopherol | Wikipedia |
| DELTA-TOCOPHEROL | MetaCyc |
| FDB002432 | FooDB |
| HMDB0002902 | HMDB |
| LMPR02020066 | LIPID MAPS |
| US2006112450 | Patent |
| Citations |
|---|