EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O2 |
| Net Charge | 0 |
| Average Mass | 416.690 |
| Monoisotopic Mass | 416.36543 |
| SMILES | Cc1cc(O)c(C)c2c1O[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-24(6)26(29)19-23(5)27(25)30-28/h19-22,29H,8-18H2,1-7H3/t21-,22-,28-/m1/s1 |
| InChIKey | WGVKWNUPNGFDFJ-DQCZWYHMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (262184) | ||
| Panax ginseng (ncbitaxon:4054) | - | MetaboLights (MTBLS350) | From MetaboLights |
| Helianthus annuus (ncbitaxon:4232) | seed (PO:0009010) | DOI (10.1007/s11032-005-5678-5) | |
| Quercus rubra (ncbitaxon:3512) | - | DOI (10.1007/s00217-018-3150-0) | |
| Quercus robur (ncbitaxon:38942) | - | DOI (10.1007/s00217-018-3150-0) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-tocopherol (CHEBI:47771) has role food component (CHEBI:78295) |
| β-tocopherol (CHEBI:47771) has role plant metabolite (CHEBI:76924) |
| β-tocopherol (CHEBI:47771) is a tocopherol (CHEBI:27013) |
| β-tocopherol (CHEBI:47771) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| (R,R,R)-β-tocopherol | ChEBI |
| 5,8-dimethyltocol | ChEBI |
| (2R)-3,4-dihydro-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol | ChemIDplus |
| beta-Tocopherol | KEGG COMPOUND |
| (2R,4'R,8'R)-β-tocopherol | ChEBI |
| (2R)-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| β-tocopherol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14152 | KEGG COMPOUND |
| Beta-Tocopherol | Wikipedia |
| HMDB0006335 | HMDB |
| C00007364 | KNApSAcK |
| BETA-TOCOPHEROL | MetaCyc |
| LMPR02020059 | LIPID MAPS |
| FDB012381 | FooDB |
| 5256784 | ChemSpider |
| ES2232276 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:93070 | Beilstein |
| Reaxys:93070 | Reaxys |
| CAS:16698-35-4 | ChemIDplus |
| CAS:148-03-8 | KEGG COMPOUND |
| Citations |
|---|