EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | COc1cccc2c1C(=O)C1=C(C[C@H](C)O[C@@H]1C)C2=O |
| InChI | InChI=1S/C16H16O4/c1-8-7-11-13(9(2)20-8)16(18)14-10(15(11)17)5-4-6-12(14)19-3/h4-6,8-9H,7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | IAJIIJBMBCZPSW-DTWKUNHWSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eleutherin (CHEBI:4774) is a p-quinones (CHEBI:25830) |
| Eleutherin (CHEBI:4774) is a benzoisochromanequinone (CHEBI:48129) |
| Synonym | Source |
|---|---|
| Eleutherin | KEGG COMPOUND |