EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14Cl2F2N2O3 |
| Net Charge | 0 |
| Average Mass | 403.212 |
| Monoisotopic Mass | 402.03495 |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C17H14Cl2F2N2O3/c18-11-6-22-7-12(19)15(11)23-16(24)10-3-4-13(26-17(20)21)14(5-10)25-8-9-1-2-9/h3-7,9,17H,1-2,8H2,(H,22,23,24) |
| InChIKey | MNDBXUUTURYVHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. |
| Application: | anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roflumilast (CHEBI:47657) has role anti-asthmatic drug (CHEBI:49167) |
| roflumilast (CHEBI:47657) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| roflumilast (CHEBI:47657) is a aromatic ether (CHEBI:35618) |
| roflumilast (CHEBI:47657) is a benzamides (CHEBI:22702) |
| roflumilast (CHEBI:47657) is a chloropyridine (CHEBI:39173) |
| roflumilast (CHEBI:47657) is a cyclopropanes (CHEBI:51454) |
| roflumilast (CHEBI:47657) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 3-(cyclopropylmethoxy)-N-(3,5-dichloropyridin-4-yl)-4-(difluoromethoxy)benzamide |
| INNs | Source |
|---|---|
| roflumilast | KEGG DRUG |
| roflumilast | WHO MedNet |
| roflumilast | WHO MedNet |
| roflumilastum | WHO MedNet |
| Brand Name | Source |
|---|---|
| Daliresp | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3531 | DrugCentral |
| D05744 | KEGG DRUG |
| ROF | PDBeChem |
| Roflumilast | Wikipedia |
| US2008181876 | Patent |
| US2008221111 | Patent |
| WO2008017827 | Patent |
| WO2008090355 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9802592 | Reaxys |
| CAS:162401-32-3 | KEGG DRUG |
| CAS:162401-32-3 | ChemIDplus |
| Citations |
|---|