EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47657 - roflumilast
| Formula | C17H14Cl2F2N2O3 |
| Net Charge | 0 |
| Average Mass | 403.212 |
| Monoisotopic Mass | 402.03495 |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C17H14Cl2F2N2O3/c18-11-6-22-7-12(19)15(11)23-16(24)10-3-4-13(26-17(20)21)14(5-10)25-8-9-1-2-9/h3-7,9,17H,1-2,8H2,(H,22,23,24) |
| InChIKey | MNDBXUUTURYVHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-asthmatic drug A drug used to treat asthma. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roflumilast (CHEBI:47657) has role anti-asthmatic agent (CHEBI:65023) |
| roflumilast (CHEBI:47657) has role anti-asthmatic drug (CHEBI:49167) |
| roflumilast (CHEBI:47657) has role anti-obesity agent (CHEBI:74518) |
| roflumilast (CHEBI:47657) has role antidepressant (CHEBI:35469) |
| roflumilast (CHEBI:47657) has role antineoplastic agent (CHEBI:35610) |
| roflumilast (CHEBI:47657) has role antipsoriatic (CHEBI:50748) |
| roflumilast (CHEBI:47657) has role antipsychotic agent (CHEBI:35476) |
| roflumilast (CHEBI:47657) has role dermatologic drug (CHEBI:50177) |
| roflumilast (CHEBI:47657) has role hypoglycemic agent (CHEBI:35526) |
| roflumilast (CHEBI:47657) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| roflumilast (CHEBI:47657) is a aromatic ether (CHEBI:35618) |
| roflumilast (CHEBI:47657) is a benzamides (CHEBI:22702) |
| roflumilast (CHEBI:47657) is a chloropyridine (CHEBI:39173) |
| roflumilast (CHEBI:47657) is a cyclopropanes (CHEBI:51454) |
| roflumilast (CHEBI:47657) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 3-(cyclopropylmethoxy)-N-(3,5-dichloropyridin-4-yl)-4-(difluoromethoxy)benzamide |
| INNs | Source |
|---|---|
| roflumilast | WHO MedNet |
| roflumilast | WHO MedNet |
| roflumilast | KEGG DRUG |
| roflumilastum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Arq-151 | ChEMBL |
| ARQ-154 (ROFLUMILAST FOAM) | ChEMBL |
| B-9302-107 | ChEMBL |
| BY-217 | ChEMBL |
| BYK-20869 | ChEMBL |
| Zoryve | ChEMBL |
| Brand Name | Source |
|---|---|
| Daliresp | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3531 | DrugCentral |
| D05744 | KEGG DRUG |
| ROF | PDBeChem |
| Roflumilast | Wikipedia |
| US2008181876 | Patent |
| US2008221111 | Patent |
| WO2008017827 | Patent |
| WO2008090355 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9802592 | Reaxys |
| CAS:162401-32-3 | KEGG DRUG |
| CAS:162401-32-3 | ChemIDplus |
| Citations |
|---|