EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14Cl2F2N2O3 |
| Net Charge | 0 |
| Average Mass | 403.212 |
| Monoisotopic Mass | 402.03495 |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C17H14Cl2F2N2O3/c18-11-6-22-7-12(19)15(11)23-16(24)10-3-4-13(26-17(20)21)14(5-10)25-8-9-1-2-9/h3-7,9,17H,1-2,8H2,(H,22,23,24) |
| InChIKey | MNDBXUUTURYVHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. hypoglycemic agent A drug which lowers the blood glucose level. antipsoriatic A drug used to treat psoriasis. anti-asthmatic drug A drug used to treat asthma. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roflumilast (CHEBI:47657) has role anti-asthmatic agent (CHEBI:65023) |
| roflumilast (CHEBI:47657) has role anti-asthmatic drug (CHEBI:49167) |
| roflumilast (CHEBI:47657) has role anti-obesity agent (CHEBI:74518) |
| roflumilast (CHEBI:47657) has role antidepressant (CHEBI:35469) |
| roflumilast (CHEBI:47657) has role antineoplastic agent (CHEBI:35610) |
| roflumilast (CHEBI:47657) has role antipsoriatic (CHEBI:50748) |
| roflumilast (CHEBI:47657) has role antipsychotic agent (CHEBI:35476) |
| roflumilast (CHEBI:47657) has role dermatologic drug (CHEBI:50177) |
| roflumilast (CHEBI:47657) has role hypoglycemic agent (CHEBI:35526) |
| roflumilast (CHEBI:47657) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| roflumilast (CHEBI:47657) is a aromatic ether (CHEBI:35618) |
| roflumilast (CHEBI:47657) is a benzamides (CHEBI:22702) |
| roflumilast (CHEBI:47657) is a chloropyridine (CHEBI:39173) |
| roflumilast (CHEBI:47657) is a cyclopropanes (CHEBI:51454) |
| roflumilast (CHEBI:47657) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 3-(cyclopropylmethoxy)-N-(3,5-dichloropyridin-4-yl)-4-(difluoromethoxy)benzamide |
| INNs | Source |
|---|---|
| roflumilast | WHO MedNet |
| roflumilast | WHO MedNet |
| roflumilast | KEGG DRUG |
| roflumilastum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Arq-151 | ChEMBL |
| ARQ-154 (ROFLUMILAST FOAM) | ChEMBL |
| B-9302-107 | ChEMBL |
| BY-217 | ChEMBL |
| BYK-20869 | ChEMBL |
| Zoryve | ChEMBL |
| Brand Name | Source |
|---|---|
| Daliresp | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3531 | DrugCentral |
| D05744 | KEGG DRUG |
| ROF | PDBeChem |
| Roflumilast | Wikipedia |
| US2008181876 | Patent |
| US2008221111 | Patent |
| WO2008017827 | Patent |
| WO2008090355 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9802592 | Reaxys |
| CAS:162401-32-3 | KEGG DRUG |
| CAS:162401-32-3 | ChemIDplus |
| Citations |
|---|