EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21ClFN5O3 |
| Net Charge | 0 |
| Average Mass | 433.871 |
| Monoisotopic Mass | 433.13170 |
| SMILES | C#CCCCn1c(Cc2cc(OC)c(OC)c(OC)c2Cl)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C20H21ClFN5O3/c1-5-6-7-8-27-13(24-15-18(23)25-20(22)26-19(15)27)10-11-9-12(28-2)16(29-3)17(30-4)14(11)21/h1,9H,6-8,10H2,2-4H3,(H2,23,25,26) |
| InChIKey | KCIOVTSUEXGUFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) has functional parent adenine (CHEBI:16708) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) has role antineoplastic agent (CHEBI:35610) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) has role Hsp90 inhibitor (CHEBI:63962) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) is a 6-aminopurines (CHEBI:20706) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) is a acetylenic compound (CHEBI:73474) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) is a methoxybenzenes (CHEBI:51683) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) is a monochlorobenzenes (CHEBI:83403) |
| 8-(2-chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-pent-4-yn-1-yl-9H-purin-6-amine (CHEBI:47628) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 8-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-2-fluoro-9-(pent-4-yn-1-yl)-9H-purin-6-amine |
| Synonym | Source |
|---|---|
| PU24FCl | ChEBI |
| Citations |
|---|