EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 381.259 |
| Monoisotopic Mass | 380.06945 |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-24-15-7-6-11(8-16(15)25-12-4-2-3-5-12)18(23)22-17-13(19)9-21-10-14(17)20/h6-10,12H,2-5H2,1H3,(H,21,22,23) |
| InChIKey | RRRUXBQSQLKHEL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. anti-inflammatory agent Any compound that has anti-inflammatory effects. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piclamilast (CHEBI:47619) has role anti-asthmatic drug (CHEBI:49167) |
| piclamilast (CHEBI:47619) has role anti-inflammatory agent (CHEBI:67079) |
| piclamilast (CHEBI:47619) has role bronchodilator agent (CHEBI:35523) |
| piclamilast (CHEBI:47619) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| piclamilast (CHEBI:47619) is a aromatic ether (CHEBI:35618) |
| piclamilast (CHEBI:47619) is a benzamides (CHEBI:22702) |
| piclamilast (CHEBI:47619) is a chloropyridine (CHEBI:39173) |
| piclamilast (CHEBI:47619) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 3-(cyclopentyloxy)-N-(3,5-dichloropyridin-4-yl)-4-methoxybenzamide |
| INNs | Source |
|---|---|
| piclamilast | WHO MedNet |
| piclamilast | WHO MedNet |
| piclamilast | WHO MedNet |
| piclamilastum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-(cyclopentyloxy)-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide | ChemIDplus |
| 3-(cyclopentyloxy)-N-(3,5-dichloro-4-pyridyl)-p-anisamide | ChemIDplus |
| RP 73-401 | ChemIDplus |
| RP 73401 | ChemIDplus |
| RP-73-401 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05474 | KEGG DRUG |
| DB01791 | DrugBank |
| Piclamilast | Wikipedia |
| PIL | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6937319 | Reaxys |
| CAS:144035-83-6 | ChemIDplus |
| Citations |
|---|