EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H2Cl4O2 |
| Net Charge | 0 |
| Average Mass | 271.914 |
| Monoisotopic Mass | 269.88089 |
| SMILES | O=C1OCc2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| InChI | InChI=1S/C8H2Cl4O2/c9-4-2-1-14-8(13)3(2)5(10)7(12)6(4)11/h1H2 |
| InChIKey | NMWKWBPNKPGATC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) has functional parent 2-benzofuran-1(3H)-one (CHEBI:38085) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) has role antifungal agrochemical (CHEBI:86328) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) has role melanin synthesis inhibitor (CHEBI:64933) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) is a organic heterobicyclic compound (CHEBI:27171) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) is a propan-1-ol (CHEBI:28831) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) is a tetrachlorobenzene (CHEBI:26888) |
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one (CHEBI:47617) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one |
| Synonyms | Source |
|---|---|
| 4,5,6,7-tetrachloro-1(3H)-isobenzofuranone | ChemIDplus |
| 4,5,6,7-tetrachlorophthalide | Alan Wood's Pesticides |
| Bayer 96610 | ChemIDplus |
| fthalide | Alan Wood's Pesticides |
| KF-32 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Rabcide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:182477 | Reaxys |
| CAS:27355-22-2 | NIST Chemistry WebBook |
| CAS:27355-22-2 | KEGG COMPOUND |
| CAS:27355-22-2 | ChemIDplus |
| Citations |
|---|