EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClNO4 |
| Net Charge | 0 |
| Average Mass | 361.825 |
| Monoisotopic Mass | 361.10809 |
| SMILES | CC(C)(Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IIBYAHWJQTYFKB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bezafibrate (CHEBI:47612) has functional parent propionic acid (CHEBI:30768) |
| bezafibrate (CHEBI:47612) has role antilipemic drug (CHEBI:35679) |
| bezafibrate (CHEBI:47612) has role environmental contaminant (CHEBI:78298) |
| bezafibrate (CHEBI:47612) has role geroprotector (CHEBI:176497) |
| bezafibrate (CHEBI:47612) has role xenobiotic (CHEBI:35703) |
| bezafibrate (CHEBI:47612) is a aromatic ether (CHEBI:35618) |
| bezafibrate (CHEBI:47612) is a monocarboxylic acid (CHEBI:25384) |
| bezafibrate (CHEBI:47612) is a monocarboxylic acid amide (CHEBI:29347) |
| bezafibrate (CHEBI:47612) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-{4-[2-(4-chlorobenzamido)ethyl]phenoxy}-2-methylpropanoic acid |
| INNs | Source |
|---|---|
| bezafibrato | DrugBank |
| bezafibratum | DrugBank |
| bezafibrate | ChemIDplus |
| Synonyms | Source |
|---|---|
| Bezatol SR (TN) | KEGG DRUG |
| 2-(p-(2-(p-Chlorobenzamido)ethyl)phenoxy)-2-methylpropionic acid | ChemIDplus |
| Cedur | ChEBI |
| Brand Names | Source |
|---|---|
| Befizal | DrugBank |
| Bezalip | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D01366 | KEGG DRUG |
| PEM | PDBeChem |
| DB01393 | DrugBank |
| DE2149070 | Patent |
| US3781328 | Patent |
| Bezafibrate | Wikipedia |
| HMDB0015465 | HMDB |
| LSM-3015 | LINCS |
| 362 | DrugCentral |
| 35728 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4267656 | Reaxys |
| CAS:41859-67-0 | KEGG DRUG |
| CAS:41859-67-0 | ChemIDplus |
| Citations |
|---|