EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClNO4 |
| Net Charge | 0 |
| Average Mass | 361.825 |
| Monoisotopic Mass | 361.10809 |
| SMILES | CC(C)(Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IIBYAHWJQTYFKB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticholesteremic drug A substance used to lower plasma cholesterol levels. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bezafibrate (CHEBI:47612) has functional parent propionic acid (CHEBI:30768) |
| bezafibrate (CHEBI:47612) has role anticholesteremic drug (CHEBI:35821) |
| bezafibrate (CHEBI:47612) has role antilipemic drug (CHEBI:35679) |
| bezafibrate (CHEBI:47612) has role antineoplastic agent (CHEBI:35610) |
| bezafibrate (CHEBI:47612) has role antipsychotic agent (CHEBI:35476) |
| bezafibrate (CHEBI:47612) has role cardiovascular drug (CHEBI:35554) |
| bezafibrate (CHEBI:47612) has role environmental contaminant (CHEBI:78298) |
| bezafibrate (CHEBI:47612) has role geroprotector (CHEBI:176497) |
| bezafibrate (CHEBI:47612) has role hypoglycemic agent (CHEBI:35526) |
| bezafibrate (CHEBI:47612) has role xenobiotic (CHEBI:35703) |
| bezafibrate (CHEBI:47612) is a aromatic ether (CHEBI:35618) |
| bezafibrate (CHEBI:47612) is a monocarboxylic acid (CHEBI:25384) |
| bezafibrate (CHEBI:47612) is a monocarboxylic acid amide (CHEBI:29347) |
| bezafibrate (CHEBI:47612) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-{4-[2-(4-chlorobenzamido)ethyl]phenoxy}-2-methylpropanoic acid |
| INNs | Source |
|---|---|
| bezafibrate | ChemIDplus |
| bezafibrato | DrugBank |
| bezafibratum | DrugBank |
| Synonyms | Source |
|---|---|
| 2-(p-(2-(p-Chlorobenzamido)ethyl)phenoxy)-2-methylpropionic acid | ChemIDplus |
| Bezatol sr | ChEMBL |
| Bezatol SR (TN) | KEGG DRUG |
| BM 15.075 | ChEMBL |
| BM-15.075 | ChEMBL |
| BM-15075 | ChEMBL |
| Brand Names | Source |
|---|---|
| Befizal | DrugBank |
| Bezagen xl | ChEMBL |
| Bezalip | DrugBank |
| Bezalip-mono | ChEMBL |
| Fibrazate xl | ChEMBL |
| Liparol xl | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 35728 | ChemSpider |
| 362 | DrugCentral |
| Bezafibrate | Wikipedia |
| D01366 | KEGG DRUG |
| DB01393 | DrugBank |
| DE2149070 | Patent |
| HMDB0015465 | HMDB |
| LSM-3015 | LINCS |
| PEM | PDBeChem |
| US3781328 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4267656 | Reaxys |
| CAS:41859-67-0 | ChemIDplus |
| CAS:41859-67-0 | KEGG DRUG |
| Citations |
|---|