EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16NO.Cl |
| Net Charge | 0 |
| Average Mass | 201.697 |
| Monoisotopic Mass | 201.09204 |
| SMILES | CC[N+](C)(C)c1cccc(O)c1.[Cl-] |
| InChI | InChI=1S/C10H15NO.ClH/c1-4-11(2,3)9-6-5-7-10(12)8-9;/h5-8H,4H2,1-3H3;1H |
| InChIKey | BXKDSDJJOVIHMX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | antidote Any protective agent counteracting or neutralizing the action of poisons. diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edrophonium chloride (CHEBI:4759) has part edrophonium (CHEBI:251408) |
| edrophonium chloride (CHEBI:4759) has role antidote (CHEBI:50247) |
| edrophonium chloride (CHEBI:4759) has role diagnostic agent (CHEBI:33295) |
| edrophonium chloride (CHEBI:4759) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| edrophonium chloride (CHEBI:4759) is a chloride salt (CHEBI:23114) |
| edrophonium chloride (CHEBI:4759) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| N-ethyl-3-hydroxy-N,N-dimethylanilinium chloride |
| INNs | Source |
|---|---|
| chlorure d'edrophonium | ChemIDplus |
| cloruro de edrofonio | ChemIDplus |
| edrophonii chloridum | ChemIDplus |
| edrophonium chloride | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-hydroxy-N,N-dimethyl-N-ethylanilinium chloride | ChEBI |
| (3-hydroxyphenyl)dimethylethylammonium chloride | ChEBI |
| Antirex | ChEMBL |
| EDROPHONIUM CHLORIDE | ChEMBL |
| N-ethyl-3-hydroxy-N,N-dimethylbenzenaminium chloride | ChEBI |
| ethyl(m-hydroxyphenyl)dimethylammonium chloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Camsilon | ChEMBL |
| Edrophonium chloride component of enlon-plus | ChEMBL |
| Edrophonium chloride preservative free | ChEMBL |
| Enlon | ChEMBL |
| Reversol | ChEMBL |
| Tensilon | ChEMBL |
| Citations |
|---|