EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H2O3 |
| Net Charge | 0 |
| Average Mass | 98.057 |
| Monoisotopic Mass | 98.00039 |
| SMILES | O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H |
| InChIKey | FPYJFEHAWHCUMM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maleic anhydride (CHEBI:474859) has role allergen (CHEBI:50904) |
| maleic anhydride (CHEBI:474859) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| maleic anhydride (CHEBI:474859) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| furan-2,5-dione |
| Synonyms | Source |
|---|---|
| 2,5-Furandione | ChemIDplus |
| Dihydro-2,5-dioxofuran | ChemIDplus |
| Maleic acid anhydride | ChemIDplus |
| Toxilic anhydride | ChemIDplus |
| cis-Butenedioic anhydride | NIST Chemistry WebBook |
| MA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Maleic_anhydride | Wikipedia |
| Citations |
|---|