EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6Cl2N2O4S2 |
| Net Charge | 0 |
| Average Mass | 305.164 |
| Monoisotopic Mass | 303.91460 |
| SMILES | NS(=O)(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C6H6Cl2N2O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H,(H2,9,11,12)(H2,10,13,14) |
| InChIKey | GJQPMPFPNINLKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 4.2.1.1 (carbonic anhydrase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of carbonic anhydrase (EC 4.2.1.1). Such compounds reduce the secretion of H+ ions by the proximal kidney tubule. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diclofenamide (CHEBI:101085) has role antiglaucoma drug (CHEBI:39456) |
| diclofenamide (CHEBI:101085) has role EC 4.2.1.1 (carbonic anhydrase) inhibitor (CHEBI:23018) |
| diclofenamide (CHEBI:101085) has role ophthalmology drug (CHEBI:66981) |
| diclofenamide (CHEBI:101085) is a dichlorobenzene (CHEBI:23697) |
| diclofenamide (CHEBI:101085) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4,5-dichlorobenzene-1,3-disulfonamide |
| INNs | Source |
|---|---|
| dichlofenamide | ChEBI |
| diclofenamida | ChemIDplus |
| diclofenamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,3-disulfamoyl-4,5-dichlorobenzene | ChemIDplus |
| 1,3-disulfamyl-4,5-dichlorobenzene | ChemIDplus |
| 3,4-dichloro-5-sulfamylbenzenesulfonamide | ChemIDplus |
| 4,5-dichloro-1,3-benzenedisulfonamide | NIST Chemistry WebBook |
| 4,5-dichloro-1,3-disulfamoylbenzene | ChemIDplus |
| 4,5-DICHLOROBENZENE-1,3-DISULFONAMIDE | PDBeChem |