EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32ClN5O5 |
| Net Charge | 0 |
| Average Mass | 542.036 |
| Monoisotopic Mass | 541.20920 |
| SMILES | CN1CCN(CCOc2cc(OC3CCOCC3)c3c(Nc4c(Cl)ccc5c4OCO5)ncnc3c2)CC1 |
| InChI | InChI=1S/C27H32ClN5O5/c1-32-6-8-33(9-7-32)10-13-35-19-14-21-24(23(15-19)38-18-4-11-34-12-5-18)27(30-16-29-21)31-25-20(28)2-3-22-26(25)37-17-36-22/h2-3,14-16,18H,4-13,17H2,1H3,(H,29,30,31) |
| InChIKey | OUKYUETWWIPKQR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saracatinib (CHEBI:47458) has role anticoronaviral agent (CHEBI:149553) |
| saracatinib (CHEBI:47458) has role antifibrotic agent (CHEBI:233423) |
| saracatinib (CHEBI:47458) has role antineoplastic agent (CHEBI:35610) |
| saracatinib (CHEBI:47458) has role apoptosis inducer (CHEBI:68495) |
| saracatinib (CHEBI:47458) has role autophagy inducer (CHEBI:138880) |
| saracatinib (CHEBI:47458) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| saracatinib (CHEBI:47458) has role radiosensitizing agent (CHEBI:132992) |
| saracatinib (CHEBI:47458) is a N-methylpiperazine (CHEBI:46920) |
| saracatinib (CHEBI:47458) is a aromatic ether (CHEBI:35618) |
| saracatinib (CHEBI:47458) is a benzodioxoles (CHEBI:38298) |
| saracatinib (CHEBI:47458) is a diether (CHEBI:46786) |
| saracatinib (CHEBI:47458) is a organochlorine compound (CHEBI:36683) |
| saracatinib (CHEBI:47458) is a oxanes (CHEBI:46942) |
| saracatinib (CHEBI:47458) is a quinazolines (CHEBI:38530) |
| saracatinib (CHEBI:47458) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-(5-chloro-1,3-benzodioxol-4-yl)-7-[2-(4-methylpiperazin-1-yl)ethoxy]-5-(tetrahydro-2H-pyran-4-yloxy)quinazolin-4-amine |
| INNs | Source |
|---|---|
| saracatinib | WHO MedNet |
| saracatinib | WHO MedNet |
| saracatinib | WHO MedNet |
| saracatinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZ-10353926 | LINCS |
| AZD 0530 | ChemIDplus |
| AZD-0530 | LINCS |
| AZD0530 | ChemIDplus |
| N-(5-chloro-1,3-benzodioxol-4-yl)-7-[2-(4-methyl-1-piperazinyl)ethoxy]-5-[(tetrahydro-2H-pyran-4-yl)oxy]-4-quinazolinamine | ChEBI |
| N-(5-chloro-2H-1,3-benzodioxol-4-yl)-7-[2-(4-methylpiperazin-1-yl)ethoxy]-5-[(oxan-4-yl)oxy]quinazolin-4-amine | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:379231-04-6 | ChemIDplus |
| Citations |
|---|