EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11ClN2O5S |
| Net Charge | 0 |
| Average Mass | 330.749 |
| Monoisotopic Mass | 330.00772 |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O5S/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19/h1-5,15H,6H2,(H,16,17)(H2,14,18,19) |
| InChIKey | ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. hypoglycemic agent A drug which lowers the blood glucose level. loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. antifibrotic agent Any agent which acts to reduce fibrosis. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hepatoprotective agent Any compound that is able to prevent damage to the liver. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furosemide (CHEBI:47426) has role anti-anaemic agent (CHEBI:75835) |
| furosemide (CHEBI:47426) has role antiatherosclerotic agent (CHEBI:145947) |
| furosemide (CHEBI:47426) has role antifibrotic agent (CHEBI:233423) |
| furosemide (CHEBI:47426) has role antihypertensive agent (CHEBI:35674) |
| furosemide (CHEBI:47426) has role antineoplastic agent (CHEBI:35610) |
| furosemide (CHEBI:47426) has role antipsychotic agent (CHEBI:35476) |
| furosemide (CHEBI:47426) has role cardiovascular drug (CHEBI:35554) |
| furosemide (CHEBI:47426) has role environmental contaminant (CHEBI:78298) |
| furosemide (CHEBI:47426) has role hepatoprotective agent (CHEBI:62868) |
| furosemide (CHEBI:47426) has role hypoglycemic agent (CHEBI:35526) |
| furosemide (CHEBI:47426) has role loop diuretic (CHEBI:77608) |
| furosemide (CHEBI:47426) has role renoprotective agent (CHEBI:231911) |
| furosemide (CHEBI:47426) has role xenobiotic (CHEBI:35703) |
| furosemide (CHEBI:47426) is a chlorobenzoic acid (CHEBI:23134) |
| furosemide (CHEBI:47426) is a furans (CHEBI:24129) |
| furosemide (CHEBI:47426) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-chloro-2-{[(furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid |
| INN | Source |
|---|---|
| furosemida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Furfurylamino-4-chloro-5-sulfamoylbenzoic acid | ChemIDplus |
| 4-Chloro-5-sulfamoyl-N-furfuryl-anthranilic acid | ChemIDplus |
| 4-Chloro-N-(2-furylmethyl)-5-sulfamoylanthranilic acid | ChemIDplus |
| 4-Chloro-N-furfuryl-5-sulfamoylanthranilic acid | ChemIDplus |
| Frusemide | KEGG DRUG |
| Furoscix | ChEMBL |
| Brand Names | Source |
|---|---|
| Aluzine 20 | ChEMBL |
| Aluzine 40 | ChEMBL |
| Aluzine 500 | ChEMBL |
| Aquamed | ChEMBL |
| Diuresal | ChEMBL |
| Dryptal | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1258 | DrugCentral |
| 1770 | VSDB |
| D00331 | KEGG DRUG |
| DB00695 | DrugBank |
| Furosemide | Wikipedia |
| HMDB0001933 | HMDB |
| LSM-5847 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1399731 | Reaxys |
| CAS:54-31-9 | KEGG DRUG |
| CAS:54-31-9 | ChemIDplus |
| Citations |
|---|