EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11ClN2O5S |
| Net Charge | 0 |
| Average Mass | 330.749 |
| Monoisotopic Mass | 330.00772 |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O5S/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19/h1-5,15H,6H2,(H,16,17)(H2,14,18,19) |
| InChIKey | ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furosemide (CHEBI:47426) has role environmental contaminant (CHEBI:78298) |
| furosemide (CHEBI:47426) has role loop diuretic (CHEBI:77608) |
| furosemide (CHEBI:47426) has role xenobiotic (CHEBI:35703) |
| furosemide (CHEBI:47426) is a chlorobenzoic acid (CHEBI:23134) |
| furosemide (CHEBI:47426) is a furans (CHEBI:24129) |
| furosemide (CHEBI:47426) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-chloro-2-{[(furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Furfurylamino-4-chloro-5-sulfamoylbenzoic acid | ChemIDplus |
| 4-Chloro-5-sulfamoyl-N-furfuryl-anthranilic acid | ChemIDplus |
| 4-Chloro-N-(2-furylmethyl)-5-sulfamoylanthranilic acid | ChemIDplus |
| 4-Chloro-N-furfuryl-5-sulfamoylanthranilic acid | ChemIDplus |
| Frusemide | KEGG DRUG |
| Furosemide | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1258 | DrugCentral |
| 1770 | VSDB |
| D00331 | KEGG DRUG |
| DB00695 | DrugBank |
| Furosemide | Wikipedia |
| HMDB0001933 | HMDB |
| LSM-5847 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1399731 | Reaxys |
| CAS:54-31-9 | ChemIDplus |
| CAS:54-31-9 | KEGG DRUG |
| Citations |
|---|