EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:474053 - cefazolin
| Formula | C14H14N8O4S3 |
| Net Charge | 0 |
| Average Mass | 454.519 |
| Monoisotopic Mass | 454.03001 |
| SMILES | [H][C@]12SCC(CSc3nnc(C)s3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C14H14N8O4S3/c1-6-17-18-14(29-6)28-4-7-3-27-12-9(11(24)22(12)10(7)13(25)26)16-8(23)2-21-5-15-19-20-21/h5,9,12H,2-4H2,1H3,(H,16,23)(H,25,26)/t9-,12-/m1/s1 |
| InChIKey | MLYYVTUWGNIJIB-BXKDBHETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefazolin (CHEBI:474053) has role antibacterial drug (CHEBI:36047) |
| cefazolin (CHEBI:474053) is a cephalosporin (CHEBI:23066) |
| cefazolin (CHEBI:474053) is a tetrazoles (CHEBI:35689) |
| cefazolin (CHEBI:474053) is a thiadiazoles (CHEBI:38099) |
| cefazolin (CHEBI:474053) is a β-lactam antibiotic allergen (CHEBI:88225) |
| cefazolin (CHEBI:474053) is conjugate acid of cefazolin(1−) (CHEBI:53657) |
| Incoming Relation(s) |
| cefazolin(1−) (CHEBI:53657) is conjugate base of cefazolin (CHEBI:474053) |
| IUPAC Name |
|---|
| 3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-7β-[(1H-tetrazol-1-ylacetyl)amino]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefazolin | ChemIDplus |
| cefazolina | ChemIDplus |
| cefazoline | ChemIDplus |
| cefazolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cefamezin | ChemIDplus |
| Cephamezine | ChemIDplus |
| Cephazolidin | ChemIDplus |
| Cephazolin | ChemIDplus |
| Cephazoline | ChemIDplus |
| (6R,7R)-3-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-8-oxo-7-[(1H-tetrazol-1-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4169371 | Reaxys |
| CAS:25953-19-9 | KEGG COMPOUND |
| CAS:25953-19-9 | KEGG DRUG |
| CAS:25953-19-9 | DrugBank |
| CAS:25953-19-9 | ChemIDplus |
| Citations |
|---|