EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H39N5O8 |
| Net Charge | 0 |
| Average Mass | 585.658 |
| Monoisotopic Mass | 585.27986 |
| SMILES | [H][C@@]12Cc3c(N(C)C)cc(NC(=O)CNC(C)(C)C)c(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])C2 |
| InChI | InChI=1S/C29H39N5O8/c1-28(2,3)31-11-17(35)32-15-10-16(33(4)5)13-8-12-9-14-21(34(6)7)24(38)20(27(30)41)26(40)29(14,42)25(39)18(12)23(37)19(13)22(15)36/h10,12,14,21,31,36,38-39,42H,8-9,11H2,1-7H3,(H2,30,41)(H,32,35)/t12-,14-,21-,29-/m0/s1 |
| InChIKey | FPZLLRFZJZRHSY-HJYUBDRYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tigecycline (CHEBI:149836) has role antibacterial agent (CHEBI:33282) |
| tigecycline (CHEBI:149836) has role antibacterial drug (CHEBI:36047) |
| tigecycline (CHEBI:149836) has role antiinfective agent (CHEBI:35441) |
| tigecycline (CHEBI:149836) has role antineoplastic agent (CHEBI:35610) |
| tigecycline (CHEBI:149836) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tigecycline (CHEBI:149836) is a tetracyclines (CHEBI:26895) |
| tigecycline (CHEBI:149836) is conjugate base of tigecycline(1+) (CHEBI:142708) |
| Incoming Relation(s) |
| 11a-hydroxytigecycline(1+) (CHEBI:142709) has functional parent tigecycline (CHEBI:149836) |
| tigecycline(1+) (CHEBI:142708) is conjugate acid of tigecycline (CHEBI:149836) |
| IUPAC Name |
|---|
| (4S,4aS,5aR,12aS)-9-[(N-tert-butylglycyl)amino]-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INN | Source |
|---|---|
| tigeciclina | WHO MedNet |
| Synonym | Source |
|---|---|
| (4S,4aS,5aR,12aS)-9-(2-(tert-butylamino)acetamido)-4,7-bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tigecycline accord | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8379453 | Reaxys |
| CAS:220620-09-7 | ChemIDplus |
| CAS:220620-09-7 | KEGG COMPOUND |
| Citations |
|---|