EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H39N5O8 |
| Net Charge | 0 |
| Average Mass | 585.658 |
| Monoisotopic Mass | 585.27986 |
| SMILES | [H][C@@]12Cc3c(N(C)C)cc(NC(=O)CNC(C)(C)C)c(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@]1([H])C2 |
| InChI | InChI=1S/C29H39N5O8/c1-28(2,3)31-11-17(35)32-15-10-16(33(4)5)13-8-12-9-14-21(34(6)7)24(38)20(27(30)41)26(40)29(14,42)25(39)18(12)23(37)19(13)22(15)36/h10,12,14,21,31,36,38-39,42H,8-9,11H2,1-7H3,(H2,30,41)(H,32,35)/t12-,14-,21-,29-/m0/s1 |
| InChIKey | FPZLLRFZJZRHSY-HJYUBDRYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tigecycline (CHEBI:149836) has role antibacterial agent (CHEBI:33282) |
| tigecycline (CHEBI:149836) has role antibacterial drug (CHEBI:36047) |
| tigecycline (CHEBI:149836) has role antiinfective agent (CHEBI:35441) |
| tigecycline (CHEBI:149836) has role antineoplastic agent (CHEBI:35610) |
| tigecycline (CHEBI:149836) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tigecycline (CHEBI:149836) is a tetracyclines (CHEBI:26895) |
| tigecycline (CHEBI:149836) is conjugate base of tigecycline(1+) (CHEBI:142708) |
| Incoming Relation(s) |
| 11a-hydroxytigecycline(1+) (CHEBI:142709) has functional parent tigecycline (CHEBI:149836) |
| tigecycline(1+) (CHEBI:142708) is conjugate acid of tigecycline (CHEBI:149836) |
| IUPAC Name |
|---|
| (4S,4aS,5aR,12aS)-9-[(N-tert-butylglycyl)amino]-4,7-bis(dimethylamino)-3,10,12,12a-tetrahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INN | Source |
|---|---|
| tigeciclina | WHO MedNet |
| Synonym | Source |
|---|---|
| (4S,4aS,5aR,12aS)-9-(2-(tert-butylamino)acetamido)-4,7-bis(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tigecycline accord | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8379453 | Reaxys |
| CAS:220620-09-7 | ChemIDplus |
| CAS:220620-09-7 | KEGG COMPOUND |
| Citations |
|---|