EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4735 - ethylenediaminetetraacetic acid
| Formula | C10H16N2O8 |
| Net Charge | 0 |
| Average Mass | 292.244 |
| Monoisotopic Mass | 292.09067 |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | calcium chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central calcium atom at two or more points. copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antidote Any protective agent counteracting or neutralizing the action of poisons. anticoagulant An agent that prevents blood clotting. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role anticoagulant (CHEBI:50249) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role antidote (CHEBI:50247) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role antiinfective agent (CHEBI:35441) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role calcium chelator (CHEBI:232436) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role cardiovascular drug (CHEBI:35554) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role copper chelator (CHEBI:166831) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role geroprotector (CHEBI:176497) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a ethylenediamine derivative (CHEBI:31577) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a polyamino carboxylic acid (CHEBI:60892) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a tetracarboxylic acid (CHEBI:35742) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is conjugate acid of EDTA(2−) (CHEBI:64755) |
| Incoming Relation(s) |
| EDTA(2−) (CHEBI:64755) is conjugate base of ethylenediaminetetraacetic acid (CHEBI:4735) |
| IUPAC Name |
|---|
| (ethane-1,2-diyldinitrilo)tetraacetic acid |
| INNs | Source |
|---|---|
| acide édétique | WHO MedNet |
| ácido edético | WHO MedNet |
| acidum edeticum | WHO MedNet |
| edetic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,2',2'',2'''-(ethane-1,2-diylbis(azanetriyl))tetraacetic acid | ChEBI |
| 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetic acid | PDBeChem |
| 2-([2-[bis(carboxymethyl)amino]ethyl](carboxymethyl)amino)acetic acid | ChEBI |
| {[-(BIS-CARBOXYMETHYL-AMINO)-ETHYL]-CARBOXYMETHYL-AMINO}-ACETIC ACID | PDBeChem |
| edathamil | ChEBI |
| edetic acid | ChEMBL |
| Brand Name | Source |
|---|---|
| Versene acid | ChEMBL |
| Citations |
|---|