EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4735 - ethylenediaminetetraacetic acid
| Formula | C10H16N2O8 |
| Net Charge | 0 |
| Average Mass | 292.244 |
| Monoisotopic Mass | 292.09067 |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. calcium chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central calcium atom at two or more points. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anticoagulant An agent that prevents blood clotting. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role anticoagulant (CHEBI:50249) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role antidote (CHEBI:50247) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role calcium chelator (CHEBI:232436) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role copper chelator (CHEBI:166831) |
| ethylenediaminetetraacetic acid (CHEBI:4735) has role geroprotector (CHEBI:176497) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a ethylenediamine derivative (CHEBI:31577) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a polyamino carboxylic acid (CHEBI:60892) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is a tetracarboxylic acid (CHEBI:35742) |
| ethylenediaminetetraacetic acid (CHEBI:4735) is conjugate acid of EDTA(2−) (CHEBI:64755) |
| Incoming Relation(s) |
| EDTA(2−) (CHEBI:64755) is conjugate base of ethylenediaminetetraacetic acid (CHEBI:4735) |
| IUPAC Name |
|---|
| (ethane-1,2-diyldinitrilo)tetraacetic acid |
| INNs | Source |
|---|---|
| ácido edético | WHO MedNet |
| acide édétique | WHO MedNet |
| edetic acid | WHO MedNet |
| acidum edeticum | WHO MedNet |
| Synonyms | Source |
|---|---|
| EDTA | KEGG COMPOUND |
| (ethylenedinitrilo)tetraacetic acid | ChEBI |
| ethylenediaminetetraacetic acid | IUPAC |
| H4edta | IUPAC |
| N,N'-1,2-Ethane diylbis-(N-(carboxymethyl)glycine) | NIST Chemistry WebBook |
| {[-(BIS-CARBOXYMETHYL-AMINO)-ETHYL]-CARBOXYMETHYL-AMINO}-ACETIC ACID | PDBeChem |
| Citations |
|---|